C24H30N2O3 — CID 101362283
(1S,5R,7R)-4-[(2S)-2-hydroxy-2-(2-methylidenecyclopentyl)acetyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 101362283) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (1S,5R,7R)-4-[(2S)-2-hydroxy-2-(2-methylidenecyclopentyl)acetyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | (1S,5R,7R)-4-[(2S)-2-hydroxy-2-(2-methylidenecyclopentyl)acetyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 101362283 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (1S,5R,7R)-4-[(2S)-2-hydroxy-2-(2-methylidenecyclopentyl)acetyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | C=C1CCCC1[C@H](O)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C |
| InChI | InChI=1S/C24H30N2O3/c1-15-8-7-11-18(15)20(27)21(28)26-19-14-16-12-13-24(19,23(16,2)3)22(29)25(26)17-9-5-4-6-10-17/h4-6,9-10,16,18-20,27H,1,7-8,11-14H2,2-3H3/t16-,18?,19-,20+,24+/m1/s1 |
| InChIKey | ZNVKGRMXUORMIQ-PNZHIRFKSA-N |
| XLogP | 3.69 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|