C12H24O3S — CID 101362526
S-tert-butyl (5S)-5,6-dihydroxy-6-methylheptanethioate (PubChem CID 101362526) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is S-tert-butyl (5S)-5,6-dihydroxy-6-methylheptanethioate.
| Compound Name | S-tert-butyl (5S)-5,6-dihydroxy-6-methylheptanethioate |
|---|---|
| PubChem CID | 101362526 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | S-tert-butyl (5S)-5,6-dihydroxy-6-methylheptanethioate |
| SMILES | CC(C)(C)SC(=O)CCC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C12H24O3S/c1-11(2,3)16-10(14)8-6-7-9(13)12(4,5)15/h9,13,15H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | NKWYKOMPEVWWHJ-VIFPVBQESA-N |
| XLogP | 2.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|