About tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate
tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate (PubChem CID 101362730) has the molecular formula C16H25NO4S
and a molecular weight of 327.45 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate |
| PubChem CID | 101362730 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO4S/c1-15(2,3)13(17-14(18)21-16(4,5)6)22(19,20)12-10-8-7-9-11-12/h7-11,13H,1-6H3,(H,17,18) |
| InChIKey | GVWMYXCZKNPFEF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate?
The IUPAC name of tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate (CID 101362730) is tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate.
What is the SMILES notation for tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate?
The canonical SMILES for tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate is CC(C)(C)OC(=O)NC(C(C)(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate?
The InChIKey is GVWMYXCZKNPFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4S/c1-15(2,3)13(17-14(18)21-16(4,5)6)22(19,20)12-10-8-7-9-11-12/h7-11,13H,1-6H3,(H,17,18).
What are the key properties of tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate?
tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate has a molecular weight of 327.45 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-(benzenesulfonyl)-2,2-dimethylpropyl]carbamate is sourced from PubChem (CID 101362730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).