C13H20O7 — CID 101362830
(5R,8S,9S)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one (PubChem CID 101362830) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is (5R,8S,9S)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one.
| Compound Name | (5R,8S,9S)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 101362830 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (5R,8S,9S)-8-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-2,2-dimethyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
| SMILES | CC1(C)OC[C@H]([C@H]2OC(=O)[C@@]3(COC(C)(C)O3)[C@H]2O)O1 |
| InChI | InChI=1S/C13H20O7/c1-11(2)16-5-7(19-11)8-9(14)13(10(15)18-8)6-17-12(3,4)20-13/h7-9,14H,5-6H2,1-4H3/t7-,8-,9+,13-/m1/s1 |
| InChIKey | OLTWEFIDDWBYDM-RVBSWOSCSA-N |
| XLogP | -0.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |