C15H19NO7 — CID 101363043
cis-dimethyl (3S,4R)-3-ethenyl-4-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclopentane-1,1-dicarboxylate (PubChem CID 101363043) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is cis-dimethyl (3S,4R)-3-ethenyl-4-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3S,4R)-3-ethenyl-4-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101363043 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | cis-dimethyl (3S,4R)-3-ethenyl-4-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@H]1C(=O)N1CCOC1=O |
| InChI | InChI=1S/C15H19NO7/c1-4-9-7-15(12(18)21-2,13(19)22-3)8-10(9)11(17)16-5-6-23-14(16)20/h4,9-10H,1,5-8H2,2-3H3/t9-,10-/m1/s1 |
| InChIKey | WUJCWOPWRXQTSD-NXEZZACHSA-N |
| XLogP | 0.51 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|