About S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate
S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate (PubChem CID 101363329) has the molecular formula C35H46O2S
and a molecular weight of 530.82 g/mol. Its IUPAC name is S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate.
Molecular Properties
| Compound Name | S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate |
| PubChem CID | 101363329 |
| Molecular Formula | C35H46O2S |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate |
| SMILES | CCCCCCCCc1ccc(SC(=O)c2ccc(-c3ccc(O[C@@H](C)CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H46O2S/c1-4-6-8-10-11-13-15-29-16-26-34(27-17-29)38-35(36)32-20-18-30(19-21-32)31-22-24-33(25-23-31)37-28(3)14-12-9-7-5-2/h16-28H,4-15H2,1-3H3/t28-/m0/s1 |
| InChIKey | XEPOFZUJABTGJM-NDEPHWFRSA-N |
| XLogP | 10.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate?
The IUPAC name of S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate (CID 101363329) is S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate.
What is the SMILES notation for S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate?
The canonical SMILES for S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate is CCCCCCCCc1ccc(SC(=O)c2ccc(-c3ccc(O[C@@H](C)CCCCCC)cc3)cc2)cc1.
What is the InChIKey of S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate?
The InChIKey is XEPOFZUJABTGJM-NDEPHWFRSA-N. The full InChI is InChI=1S/C35H46O2S/c1-4-6-8-10-11-13-15-29-16-26-34(27-17-29)38-35(36)32-20-18-30(19-21-32)31-22-24-33(25-23-31)37-28(3)14-12-9-7-5-2/h16-28H,4-15H2,1-3H3/t28-/m0/s1.
What are the key properties of S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate?
S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate has a molecular weight of 530.82 g/mol, XLogP of 10.93, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-octylphenyl) 4-[4-[(2S)-octan-2-yl]oxyphenyl]benzenecarbothioate is sourced from PubChem (CID 101363329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).