About 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea (PubChem CID 10136373) has the molecular formula C19H20Cl2FN3O2
and a molecular weight of 412.29 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea |
| PubChem CID | 10136373 |
| Molecular Formula | C19H20Cl2FN3O2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H20Cl2FN3O2/c20-17-5-4-13(8-18(17)21)11-25-6-7-27-16(12-25)10-23-19(26)24-15-3-1-2-14(22)9-15/h1-5,8-9,16H,6-7,10-12H2,(H2,23,24,26) |
| InChIKey | UHYMDBFNUWROLZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea?
The IUPAC name of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea (CID 10136373) is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea.
What is the SMILES notation for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea?
The canonical SMILES for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea is O=C(NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1)Nc1cccc(F)c1.
What is the InChIKey of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea?
The InChIKey is UHYMDBFNUWROLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20Cl2FN3O2/c20-17-5-4-13(8-18(17)21)11-25-6-7-27-16(12-25)10-23-19(26)24-15-3-1-2-14(22)9-15/h1-5,8-9,16H,6-7,10-12H2,(H2,23,24,26).
What are the key properties of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea?
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea has a molecular weight of 412.29 g/mol, XLogP of 4.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-(3-fluorophenyl)urea is sourced from PubChem (CID 10136373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).