C25H26FN3O2 — CID 101364635
N-[6-[4-[2-(3-fluorophenyl)ethyl]phenoxy]-3-pyridinyl]-2-pyrrolidin-1-ylacetamide (PubChem CID 101364635) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[6-[4-[2-(3-fluorophenyl)ethyl]phenoxy]-3-pyridinyl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[6-[4-[2-(3-fluorophenyl)ethyl]phenoxy]-3-pyridinyl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 101364635 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[6-[4-[2-(3-fluorophenyl)ethyl]phenoxy]-3-pyridinyl]-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(CN1CCCC1)Nc1ccc(Oc2ccc(CCc3cccc(F)c3)cc2)nc1 |
| InChI | InChI=1S/C25H26FN3O2/c26-21-5-3-4-20(16-21)7-6-19-8-11-23(12-9-19)31-25-13-10-22(17-27-25)28-24(30)18-29-14-1-2-15-29/h3-5,8-13,16-17H,1-2,6-7,14-15,18H2,(H,28,30) |
| InChIKey | PNBHGXLYAVBEHD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |