C18H22N3NaO8S3 — CID 101364852
sodium N-[6-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanimidate (PubChem CID 101364852) has the molecular formula C18H22N3NaO8S3 and a molecular weight of 527.58 g/mol. Its IUPAC name is sodium N-[6-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanimidate.
| Compound Name | sodium N-[6-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanimidate |
|---|---|
| PubChem CID | 101364852 |
| Molecular Formula | C18H22N3NaO8S3 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | sodium N-[6-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-6-oxohexyl]-3-(pyridin-2-yldisulfanyl)propanimidate |
| SMILES | O=C(CCCCC/N=C(\[O-])CCSSc1ccccn1)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na+] |
| InChI | InChI=1S/C18H23N3O8S3.Na/c22-14(8-11-30-31-15-6-3-5-10-20-15)19-9-4-1-2-7-17(24)29-21-16(23)12-13(18(21)25)32(26,27)28;/h3,5-6,10,13H,1-2,4,7-9,11-12H2,(H,19,22)(H,26,27,28);/q;+1/p-1 |
| InChIKey | ZAPNXDUFCQIHFS-UHFFFAOYSA-M |
| XLogP | -1.99 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|