About tetracene-2,8-dithiol
tetracene-2,8-dithiol (PubChem CID 101365103) has the molecular formula C18H12S2
and a molecular weight of 292.43 g/mol. Its IUPAC name is tetracene-2,8-dithiol.
Molecular Properties
| Compound Name | tetracene-2,8-dithiol |
| PubChem CID | 101365103 |
| Molecular Formula | C18H12S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | tetracene-2,8-dithiol |
| SMILES | Sc1ccc2cc3cc4cc(S)ccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12S2/c19-17-3-1-11-5-13-8-16-10-18(20)4-2-12(16)6-14(13)7-15(11)9-17/h1-10,19-20H |
| InChIKey | CUPLRXWYWAEFIK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tetracene-2,8-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracene-2,8-dithiol?
The IUPAC name of tetracene-2,8-dithiol (CID 101365103) is tetracene-2,8-dithiol.
What is the SMILES notation for tetracene-2,8-dithiol?
The canonical SMILES for tetracene-2,8-dithiol is Sc1ccc2cc3cc4cc(S)ccc4cc3cc2c1.
What is the InChIKey of tetracene-2,8-dithiol?
The InChIKey is CUPLRXWYWAEFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12S2/c19-17-3-1-11-5-13-8-16-10-18(20)4-2-12(16)6-14(13)7-15(11)9-17/h1-10,19-20H.
What are the key properties of tetracene-2,8-dithiol?
tetracene-2,8-dithiol has a molecular weight of 292.43 g/mol, XLogP of 5.72, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetracene-2,8-dithiol is sourced from PubChem (CID 101365103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).