C22H23NO8 — CID 101365110
(4R)-4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]-5-oxo-5-phenylmethoxypentanoic acid (PubChem CID 101365110) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is (4R)-4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]-5-oxo-5-phenylmethoxypentanoic acid.
| Compound Name | (4R)-4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]-5-oxo-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 101365110 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4R)-4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]carbamoyl]-5-oxo-5-phenylmethoxypentanoic acid |
| SMILES | O=C(O)CC[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO8/c24-16-8-6-14(7-9-16)12-18(21(28)29)23-20(27)17(10-11-19(25)26)22(30)31-13-15-4-2-1-3-5-15/h1-9,17-18,24H,10-13H2,(H,23,27)(H,25,26)(H,28,29)/t17-,18+/m1/s1 |
| InChIKey | CNHGEOSTGPXQRY-MSOLQXFVSA-N |
| XLogP | 1.73 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|