C22H30N4O4 — CID 10136534
N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 10136534) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 10136534 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-benzyl-5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | O=C(C[C@@H](CCCC1CCCCC1)c1nc(C(=O)NCc2ccccc2)no1)NO |
| InChI | InChI=1S/C22H30N4O4/c27-19(25-29)14-18(13-7-12-16-8-3-1-4-9-16)22-24-20(26-30-22)21(28)23-15-17-10-5-2-6-11-17/h2,5-6,10-11,16,18,29H,1,3-4,7-9,12-15H2,(H,23,28)(H,25,27)/t18-/m1/s1 |
| InChIKey | IXUAWIOCMPIPOM-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|