About (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol
(3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol (PubChem CID 101365455) has the molecular formula C21H42O2Si
and a molecular weight of 354.65 g/mol. Its IUPAC name is (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol.
Molecular Properties
| Compound Name | (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol |
| PubChem CID | 101365455 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol |
| SMILES | C=CCCC/C=C(\CCCCCC)C(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-8-10-12-14-16-19(17-15-13-11-9-2)20(22)18-23-24(6,7)21(3,4)5/h8,16,20,22H,1,9-15,17-18H2,2-7H3/b19-16+ |
| InChIKey | GFLOBCFZEMYVJI-KNTRCKAVSA-N |
| XLogP | 6.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol?
The IUPAC name of (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol (CID 101365455) is (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol.
What is the SMILES notation for (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol?
The canonical SMILES for (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol is C=CCCC/C=C(\CCCCCC)C(O)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol?
The InChIKey is GFLOBCFZEMYVJI-KNTRCKAVSA-N. The full InChI is InChI=1S/C21H42O2Si/c1-8-10-12-14-16-19(17-15-13-11-9-2)20(22)18-23-24(6,7)21(3,4)5/h8,16,20,22H,1,9-15,17-18H2,2-7H3/b19-16+.
What are the key properties of (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol?
(3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol has a molecular weight of 354.65 g/mol, XLogP of 6.62, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-[tert-butyl(dimethyl)silyl]oxy-3-hexylnona-3,8-dien-2-ol is sourced from PubChem (CID 101365455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).