About chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane
chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane (PubChem CID 101366115) has the molecular formula C11H20ClN2P
and a molecular weight of 246.72 g/mol. Its IUPAC name is chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane.
Molecular Properties
| Compound Name | chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane |
| PubChem CID | 101366115 |
| Molecular Formula | C11H20ClN2P |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane |
| SMILES | Cc1c(C)n(C(C)C)c(=PCl)n1C(C)C |
| InChI | InChI=1S/C11H20ClN2P/c1-7(2)13-9(5)10(6)14(8(3)4)11(13)15-12/h7-8H,1-6H3 |
| InChIKey | XWSKVDMPGAJXQJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane?
The IUPAC name of chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane (CID 101366115) is chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane.
What is the SMILES notation for chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane?
The canonical SMILES for chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane is Cc1c(C)n(C(C)C)c(=PCl)n1C(C)C.
What is the InChIKey of chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane?
The InChIKey is XWSKVDMPGAJXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClN2P/c1-7(2)13-9(5)10(6)14(8(3)4)11(13)15-12/h7-8H,1-6H3.
What are the key properties of chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane?
chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane has a molecular weight of 246.72 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]phosphane is sourced from PubChem (CID 101366115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).