C30H26O2 — CID 101366199
(1R,3R,5R)-1,3,8-trimethyl-4,4,9-triphenyltricyclo[5.2.0.03,5]non-8-ene-2,6-dione (PubChem CID 101366199) has the molecular formula C30H26O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (1R,3R,5R)-1,3,8-trimethyl-4,4,9-triphenyltricyclo[5.2.0.03,5]non-8-ene-2,6-dione.
| Compound Name | (1R,3R,5R)-1,3,8-trimethyl-4,4,9-triphenyltricyclo[5.2.0.03,5]non-8-ene-2,6-dione |
|---|---|
| PubChem CID | 101366199 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (1R,3R,5R)-1,3,8-trimethyl-4,4,9-triphenyltricyclo[5.2.0.03,5]non-8-ene-2,6-dione |
| SMILES | CC1=C(c2ccccc2)[C@]2(C)C(=O)[C@]3(C)[C@H](C(=O)C12)C3(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26O2/c1-19-23(20-13-7-4-8-14-20)28(2)24(19)25(31)26-29(3,27(28)32)30(26,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,24,26H,1-3H3/t24?,26-,28-,29-/m0/s1 |
| InChIKey | RYSOKNBFEKNEAG-MZFMFKAGSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |