C20H24O4 — CID 101366217
(1R,5R,10R,13R,14R)-5,10-dimethyl-14-(3-methylidene-2-oxopent-4-enyl)-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradec-11-en-6-one (PubChem CID 101366217) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,5R,10R,13R,14R)-5,10-dimethyl-14-(3-methylidene-2-oxopent-4-enyl)-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradec-11-en-6-one.
| Compound Name | (1R,5R,10R,13R,14R)-5,10-dimethyl-14-(3-methylidene-2-oxopent-4-enyl)-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradec-11-en-6-one |
|---|---|
| PubChem CID | 101366217 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1R,5R,10R,13R,14R)-5,10-dimethyl-14-(3-methylidene-2-oxopent-4-enyl)-7,9-dioxatetracyclo[8.3.1.01,8.05,13]tetradec-11-en-6-one |
| SMILES | C=CC(=C)C(=O)C[C@@H]1[C@]23CCC[C@@]4(C)C(=O)OC2O[C@]1(C)C=C[C@H]34 |
| InChI | InChI=1S/C20H24O4/c1-5-12(2)13(21)11-15-19(4)10-7-14-18(3)8-6-9-20(14,15)17(24-19)23-16(18)22/h5,7,10,14-15,17H,1-2,6,8-9,11H2,3-4H3/t14-,15-,17?,18+,19+,20+/m0/s1 |
| InChIKey | XHDGKVNSDAWICW-SHUSYBTNSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|