C18H24O2 — CID 101366620
(2R,6S)-3,3-dimethyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one (PubChem CID 101366620) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R,6S)-3,3-dimethyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one.
| Compound Name | (2R,6S)-3,3-dimethyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
|---|---|
| PubChem CID | 101366620 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2R,6S)-3,3-dimethyl-2-(2-phenylethyl)-6-prop-2-enyloxan-4-one |
| SMILES | C=CC[C@H]1CC(=O)C(C)(C)[C@@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O2/c1-4-8-15-13-16(19)18(2,3)17(20-15)12-11-14-9-6-5-7-10-14/h4-7,9-10,15,17H,1,8,11-13H2,2-3H3/t15-,17+/m0/s1 |
| InChIKey | BGBITLPEMIRWIF-DOTOQJQBSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|