C36H36N2O6 — CID 101366783
1-[(2S,3R)-3-[(2R,3S)-1-acetyl-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-3-yl]-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 101366783) has the molecular formula C36H36N2O6 and a molecular weight of 592.69 g/mol. Its IUPAC name is 1-[(2S,3R)-3-[(2R,3S)-1-acetyl-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-3-yl]-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-[(2R,3S)-1-acetyl-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-3-yl]-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 101366783 |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 1-[(2S,3R)-3-[(2R,3S)-1-acetyl-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-3-yl]-2-(3,4-dimethoxyphenyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | COc1ccc([C@@H]2[C@H]([C@H]3c4ccccc4N(C(C)=O)[C@H]3c3ccc(OC)c(OC)c3)c3ccccc3N2C(C)=O)cc1OC |
| InChI | InChI=1S/C36H36N2O6/c1-21(39)37-27-13-9-7-11-25(27)33(35(37)23-15-17-29(41-3)31(19-23)43-5)34-26-12-8-10-14-28(26)38(22(2)40)36(34)24-16-18-30(42-4)32(20-24)44-6/h7-20,33-36H,1-6H3/t33-,34+,35+,36- |
| InChIKey | RPNMJSXZLBGSIX-IYMPVJEUSA-N |
| XLogP | 6.80 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |