C36H20F4N4 — CID 101367858
2-[4-(4,5-diphenylimidazol-2-ylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-4,5-diphenylimidazole (PubChem CID 101367858) has the molecular formula C36H20F4N4 and a molecular weight of 584.58 g/mol. Its IUPAC name is 2-[4-(4,5-diphenylimidazol-2-ylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-4,5-diphenylimidazole.
| Compound Name | 2-[4-(4,5-diphenylimidazol-2-ylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 101367858 |
| Molecular Formula | C36H20F4N4 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-[4-(4,5-diphenylimidazol-2-ylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]-4,5-diphenylimidazole |
| SMILES | Fc1c(F)c(=C2N=C(c3ccccc3)C(c3ccccc3)=N2)c(F)c(F)c1=C1N=C(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C36H20F4N4/c37-27-25(35-41-31(21-13-5-1-6-14-21)32(42-35)22-15-7-2-8-16-22)28(38)30(40)26(29(27)39)36-43-33(23-17-9-3-10-18-23)34(44-36)24-19-11-4-12-20-24/h1-20H |
| InChIKey | RRGXNBQDJISULY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|