C14H17NO2S — CID 101368046
(3aS,7aR)-3-benzylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 101368046) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (3aS,7aR)-3-benzylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aS,7aR)-3-benzylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 101368046 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (3aS,7aR)-3-benzylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | O=C1O[C@@H]2CCCC[C@@H]2N1SCc1ccccc1 |
| InChI | InChI=1S/C14H17NO2S/c16-14-15(12-8-4-5-9-13(12)17-14)18-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2/t12-,13+/m0/s1 |
| InChIKey | XIGYIMOVCWUTNZ-QWHCGFSZSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|