C22H31ClN4O2 — CID 10136833
3-(2-chloro-4-methoxyphenyl)-8-ethyl-7-heptan-4-yl-1-methyl-2H-purin-6-one (PubChem CID 10136833) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 3-(2-chloro-4-methoxyphenyl)-8-ethyl-7-heptan-4-yl-1-methyl-2H-purin-6-one.
| Compound Name | 3-(2-chloro-4-methoxyphenyl)-8-ethyl-7-heptan-4-yl-1-methyl-2H-purin-6-one |
|---|---|
| PubChem CID | 10136833 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-(2-chloro-4-methoxyphenyl)-8-ethyl-7-heptan-4-yl-1-methyl-2H-purin-6-one |
| SMILES | CCCC(CCC)n1c(CC)nc2c1C(=O)N(C)CN2c1ccc(OC)cc1Cl |
| InChI | InChI=1S/C22H31ClN4O2/c1-6-9-15(10-7-2)27-19(8-3)24-21-20(27)22(28)25(4)14-26(21)18-12-11-16(29-5)13-17(18)23/h11-13,15H,6-10,14H2,1-5H3 |
| InChIKey | GEYTYQVIVZOMQN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |