C22H27NO5S — CID 101368610
methyl (4S,8S,9R,11S)-9-formyl-9-methyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodec-1(12)-ene-11-carboxylate (PubChem CID 101368610) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is methyl (4S,8S,9R,11S)-9-formyl-9-methyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodec-1(12)-ene-11-carboxylate.
| Compound Name | methyl (4S,8S,9R,11S)-9-formyl-9-methyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodec-1(12)-ene-11-carboxylate |
|---|---|
| PubChem CID | 101368610 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl (4S,8S,9R,11S)-9-formyl-9-methyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodec-1(12)-ene-11-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@](C)(C=O)[C@@H]2C3=C1CC[C@H]3CCN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-14-4-7-16(8-5-14)29(26,27)23-11-10-15-6-9-17-18(21(25)28-3)12-22(2,13-24)20(23)19(15)17/h4-5,7-8,13,15,18,20H,6,9-12H2,1-3H3/t15-,18-,20-,22-/m0/s1 |
| InChIKey | FTYQHORLBSCZLD-LYKNXKPOSA-N |
| XLogP | 2.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|