C29H36O4Si — CID 101368772
methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate (PubChem CID 101368772) has the molecular formula C29H36O4Si and a molecular weight of 476.69 g/mol. Its IUPAC name is methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate.
| Compound Name | methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate |
|---|---|
| PubChem CID | 101368772 |
| Molecular Formula | C29H36O4Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl (2R,3aS,5S)-5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-8-oxo-2,3,4,5,6,7-hexahydroazulene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CCC(=O)C1=C[C@H](C)C2 |
| InChI | InChI=1S/C29H36O4Si/c1-21-18-25-26(30)17-16-22(20-29(25,19-21)27(31)32-5)33-34(28(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,18,21-22H,16-17,19-20H2,1-5H3/t21-,22-,29-/m0/s1 |
| InChIKey | FYNPMEKNRJHYAU-SYZUXVNWSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|