C13H22O4Si — CID 101368827
(1R,5R,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 101368827) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is (1R,5R,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5R,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 101368827 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (1R,5R,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC(=O)[C@@H]2O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C13H22O4Si/c1-13(2,3)18(4,5)16-7-8-6-9(14)11-12(17-11)10(8)15/h6,10-12,15H,7H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | PNADUXBDEPDARI-GRYCIOLGSA-N |
| XLogP | 1.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|