C14H16N2O2S6 — CID 101368878
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-4-N,5-N-diethyl-1,3-dithiole-4,5-dicarboxamide (PubChem CID 101368878) has the molecular formula C14H16N2O2S6 and a molecular weight of 436.70 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-4-N,5-N-diethyl-1,3-dithiole-4,5-dicarboxamide.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-4-N,5-N-diethyl-1,3-dithiole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 101368878 |
| Molecular Formula | C14H16N2O2S6 |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-4-N,5-N-diethyl-1,3-dithiole-4,5-dicarboxamide |
| SMILES | CCNC(=O)C1=C(C(=O)NCC)SC(=C2SC3=C(SCCS3)S2)S1 |
| InChI | InChI=1S/C14H16N2O2S6/c1-3-15-9(17)7-8(10(18)16-4-2)22-13(21-7)14-23-11-12(24-14)20-6-5-19-11/h3-6H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | MULKFSSLHQBITE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |