C42H48O6 — CID 101369434
2,3,6,7,10,11-hexakis(2-ethenoxyethyl)triphenylene (PubChem CID 101369434) has the molecular formula C42H48O6 and a molecular weight of 648.84 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexakis(2-ethenoxyethyl)triphenylene.
| Compound Name | 2,3,6,7,10,11-hexakis(2-ethenoxyethyl)triphenylene |
|---|---|
| PubChem CID | 101369434 |
| Molecular Formula | C42H48O6 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | 2,3,6,7,10,11-hexakis(2-ethenoxyethyl)triphenylene |
| SMILES | C=COCCc1cc2c3cc(CCOC=C)c(CCOC=C)cc3c3cc(CCOC=C)c(CCOC=C)cc3c2cc1CCOC=C |
| InChI | InChI=1S/C42H48O6/c1-7-43-19-13-31-25-37-38(26-32(31)14-20-44-8-2)40-28-34(16-22-46-10-4)36(18-24-48-12-6)30-42(40)41-29-35(17-23-47-11-5)33(27-39(37)41)15-21-45-9-3/h7-12,25-30H,1-6,13-24H2 |
| InChIKey | CUVUTPOIPBGCCQ-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|