C19H36B2O4 — CID 101369796
2-[(3S)-4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101369796) has the molecular formula C19H36B2O4 and a molecular weight of 350.12 g/mol. Its IUPAC name is 2-[(3S)-4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3S)-4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101369796 |
| Molecular Formula | C19H36B2O4 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 2-[(3S)-4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@H](B1OC(C)(C)C(C)(C)O1)C(C)(C)C |
| InChI | InChI=1S/C19H36B2O4/c1-13(20-22-16(5,6)17(7,8)23-20)14(15(2,3)4)21-24-18(9,10)19(11,12)25-21/h14H,1H2,2-12H3/t14-/m0/s1 |
| InChIKey | JCHBTSLFEZIONS-AWEZNQCLSA-N |
| XLogP | 4.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|