C18H38Si2 — CID 101369879
[(E,3E)-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane (PubChem CID 101369879) has the molecular formula C18H38Si2 and a molecular weight of 310.67 g/mol. Its IUPAC name is [(E,3E)-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane.
| Compound Name | [(E,3E)-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 101369879 |
| Molecular Formula | C18H38Si2 |
| Molecular Weight | 310.67 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | [(E,3E)-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
| SMILES | CCCCC(=C\[Si](C)(C)C)/C(=C/[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C18H38Si2/c1-9-11-13-17(15-19(3,4)5)18(14-12-10-2)16-20(6,7)8/h15-16H,9-14H2,1-8H3/b17-15+,18-16+ |
| InChIKey | HFIWAHPMQHWSAC-YTEMWHBBSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|