C19H38O3Si — CID 101369902
(2R,3S,4R,5S)-3-methyl-4-prop-1-ynyl-1-tri(propan-2-yl)silyloxyhexane-2,5-diol (PubChem CID 101369902) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-methyl-4-prop-1-ynyl-1-tri(propan-2-yl)silyloxyhexane-2,5-diol.
| Compound Name | (2R,3S,4R,5S)-3-methyl-4-prop-1-ynyl-1-tri(propan-2-yl)silyloxyhexane-2,5-diol |
|---|---|
| PubChem CID | 101369902 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (2R,3S,4R,5S)-3-methyl-4-prop-1-ynyl-1-tri(propan-2-yl)silyloxyhexane-2,5-diol |
| SMILES | CC#C[C@@H]([C@H](C)[C@@H](O)CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)O |
| InChI | InChI=1S/C19H38O3Si/c1-10-11-18(17(9)20)16(8)19(21)12-22-23(13(2)3,14(4)5)15(6)7/h13-21H,12H2,1-9H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | FKHBQSLHGILZEY-VJANTYMQSA-N |
| XLogP | 4.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|