C11H14O2 — CID 101370441
(1R,2S,5S,6R,7S)-5-ethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 101370441) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-5-ethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5S,6R,7S)-5-ethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 101370441 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1R,2S,5S,6R,7S)-5-ethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC[C@@H]1OC(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H14O2/c1-2-8-9-6-3-4-7(5-6)10(9)11(12)13-8/h3-4,6-10H,2,5H2,1H3/t6-,7+,8+,9+,10+/m1/s1 |
| InChIKey | WQUVHGRGTUIFSA-MBGOZMDMSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|