About [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate (PubChem CID 10137057) has the molecular formula C25H30N2O4
and a molecular weight of 422.53 g/mol. Its IUPAC name is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate.
Molecular Properties
| Compound Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate |
| PubChem CID | 10137057 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N2O4/c1-3-17-26-24(29)31-20-13-15-25(16-14-20,19-9-5-4-6-10-19)18-27-23(28)21-11-7-8-12-22(21)30-2/h3-12,20H,1,13-18H2,2H3,(H,26,29)(H,27,28) |
| InChIKey | OUTNWGHCZPJTNS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate?
The IUPAC name of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate (CID 10137057) is [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate.
What is the SMILES notation for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate?
The canonical SMILES for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate is C=CCNC(=O)OC1CCC(CNC(=O)c2ccccc2OC)(c2ccccc2)CC1.
What is the InChIKey of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate?
The InChIKey is OUTNWGHCZPJTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O4/c1-3-17-26-24(29)31-20-13-15-25(16-14-20,19-9-5-4-6-10-19)18-27-23(28)21-11-7-8-12-22(21)30-2/h3-12,20H,1,13-18H2,2H3,(H,26,29)(H,27,28).
What are the key properties of [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate?
[4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate has a molecular weight of 422.53 g/mol, XLogP of 4.22, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(2-methoxybenzoyl)amino]methyl]-4-phenylcyclohexyl] N-prop-2-enylcarbamate is sourced from PubChem (CID 10137057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).