About (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol
(2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol (PubChem CID 101370808) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol.
Molecular Properties
| Compound Name | (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol |
| PubChem CID | 101370808 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol |
| SMILES | COC(OC)[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C9H20O3/c1-6(2)8(10)7(3)9(11-4)12-5/h6-10H,1-5H3/t7-,8-/m1/s1 |
| InChIKey | LCMHCLDCFBHHNW-HTQZYQBOSA-N |
| XLogP | 1.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol?
The IUPAC name of (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol (CID 101370808) is (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol.
What is the SMILES notation for (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol?
The canonical SMILES for (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol is COC(OC)[C@H](C)[C@H](O)C(C)C.
What is the InChIKey of (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol?
The InChIKey is LCMHCLDCFBHHNW-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H20O3/c1-6(2)8(10)7(3)9(11-4)12-5/h6-10H,1-5H3/t7-,8-/m1/s1.
What are the key properties of (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol?
(2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol has a molecular weight of 176.26 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-1,1-dimethoxy-2,4-dimethylpentan-3-ol is sourced from PubChem (CID 101370808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).