About [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate
[3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate (PubChem CID 101371020) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate.
Analyze [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate?
The IUPAC name of [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate (CID 101371020) is [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate.
What is the SMILES notation for [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate?
The canonical SMILES for [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate is CC(=O)OC(CC(C)(C)C)C1OC(=O)CC1C.
What is the InChIKey of [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate?
The InChIKey is VLVVTUUHXPKONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-8-6-11(15)17-12(8)10(16-9(2)14)7-13(3,4)5/h8,10,12H,6-7H2,1-5H3.
What are the key properties of [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate?
[3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate has a molecular weight of 242.31 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-dimethyl-1-(3-methyl-5-oxooxolan-2-yl)butyl] acetate is sourced from PubChem (CID 101371020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).