C69H60S9 — CID 101371507
1,3,5-tris[[3,5-bis[(4-methylphenyl)sulfanyl]phenyl]sulfanylmethyl]benzene (PubChem CID 101371507) has the molecular formula C69H60S9 and a molecular weight of 1177.84 g/mol. Its IUPAC name is 1,3,5-tris[[3,5-bis[(4-methylphenyl)sulfanyl]phenyl]sulfanylmethyl]benzene.
| Compound Name | 1,3,5-tris[[3,5-bis[(4-methylphenyl)sulfanyl]phenyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 101371507 |
| Molecular Formula | C69H60S9 |
| Molecular Weight | 1177.84 g/mol |
| Exact Mass | 1176.22 |
| IUPAC Name | 1,3,5-tris[[3,5-bis[(4-methylphenyl)sulfanyl]phenyl]sulfanylmethyl]benzene |
| SMILES | Cc1ccc(Sc2cc(SCc3cc(CSc4cc(Sc5ccc(C)cc5)cc(Sc5ccc(C)cc5)c4)cc(CSc4cc(Sc5ccc(C)cc5)cc(Sc5ccc(C)cc5)c4)c3)cc(Sc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C69H60S9/c1-46-7-19-55(20-8-46)73-64-34-61(35-65(40-64)74-56-21-9-47(2)10-22-56)70-43-52-31-53(44-71-62-36-66(75-57-23-11-48(3)12-24-57)41-67(37-62)76-58-25-13-49(4)14-26-58)33-54(32-52)45-72-63-38-68(77-59-27-15-50(5)16-28-59)42-69(39-63)78-60-29-17-51(6)18-30-60/h7-42H,43-45H2,1-6H3 |
| InChIKey | FPKXWGAJWNSBQW-UHFFFAOYSA-N |
| XLogP | 23.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1177.84 |
| LogP ≤ 5 | 23.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |