About 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine
2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine (PubChem CID 101371542) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine |
| PubChem CID | 101371542 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine |
| SMILES | CCC(=C/C=C\OCCN(C)C)CC |
| InChI | InChI=1S/C12H23NO/c1-5-12(6-2)8-7-10-14-11-9-13(3)4/h7-8,10H,5-6,9,11H2,1-4H3/b10-7- |
| InChIKey | MJJQLSDEPMBPLK-YFHOEESVSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine (CID 101371542) is 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine is CCC(=C/C=C\OCCN(C)C)CC.
What is the InChIKey of 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine?
The InChIKey is MJJQLSDEPMBPLK-YFHOEESVSA-N. The full InChI is InChI=1S/C12H23NO/c1-5-12(6-2)8-7-10-14-11-9-13(3)4/h7-8,10H,5-6,9,11H2,1-4H3/b10-7-.
What are the key properties of 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine?
2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine has a molecular weight of 197.32 g/mol, XLogP of 2.82, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-4-ethylhexa-1,3-dienoxy]-N,N-dimethylethanamine is sourced from PubChem (CID 101371542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).