C6H18As6O6 — CID 101371655
2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexarsacyclododecane (PubChem CID 101371655) has the molecular formula C6H18As6O6 and a molecular weight of 635.74 g/mol. Its IUPAC name is 2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexarsacyclododecane.
| Compound Name | 2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexarsacyclododecane |
|---|---|
| PubChem CID | 101371655 |
| Molecular Formula | C6H18As6O6 |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.64 |
| IUPAC Name | 2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexarsacyclododecane |
| SMILES | C[As]1O[As](C)O[As](C)O[As](C)O[As](C)O[As](C)O1 |
| InChI | InChI=1S/C6H18As6O6/c1-7-13-8(2)15-10(4)17-12(6)18-11(5)16-9(3)14-7/h1-6H3 |
| InChIKey | FFKVYFUCDYNLOL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|