About (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine
(E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine (PubChem CID 101372107) has the molecular formula C12H12F3N
and a molecular weight of 227.23 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine.
Molecular Properties
| Compound Name | (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine |
| PubChem CID | 101372107 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine |
| SMILES | [H]/N=C(C(/C)=C/c1ccc(C)cc1)\C(F)(F)F |
| InChI | InChI=1S/C12H12F3N/c1-8-3-5-10(6-4-8)7-9(2)11(16)12(13,14)15/h3-7,16H,1-2H3/b9-7+,16-11- |
| InChIKey | WLSZWRYTWVITAD-SZFVZERQSA-N |
| XLogP | 3.98 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine?
The IUPAC name of (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine (CID 101372107) is (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine.
What is the SMILES notation for (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine?
The canonical SMILES for (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine is [H]/N=C(C(/C)=C/c1ccc(C)cc1)\C(F)(F)F.
What is the InChIKey of (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine?
The InChIKey is WLSZWRYTWVITAD-SZFVZERQSA-N. The full InChI is InChI=1S/C12H12F3N/c1-8-3-5-10(6-4-8)7-9(2)11(16)12(13,14)15/h3-7,16H,1-2H3/b9-7+,16-11-.
What are the key properties of (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine?
(E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine has a molecular weight of 227.23 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1,1-trifluoro-3-methyl-4-(4-methylphenyl)but-3-en-2-imine is sourced from PubChem (CID 101372107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).