C21H25N3O8S2 — CID 101372167
[(2R,3R,4S,6S)-4-azido-6-methoxy-3-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 101372167) has the molecular formula C21H25N3O8S2 and a molecular weight of 511.58 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-4-azido-6-methoxy-3-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S,6S)-4-azido-6-methoxy-3-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101372167 |
| Molecular Formula | C21H25N3O8S2 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [(2R,3R,4S,6S)-4-azido-6-methoxy-3-(4-methylphenyl)sulfonyloxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1C[C@H](N=[N+]=[N-])[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C21H25N3O8S2/c1-14-4-8-16(9-5-14)33(25,26)30-13-19-21(18(23-24-22)12-20(29-3)31-19)32-34(27,28)17-10-6-15(2)7-11-17/h4-11,18-21H,12-13H2,1-3H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | YCUKMZNVXPMFFU-JSXRDJHFSA-N |
| XLogP | 3.22 |
| TPSA | 153.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|