C10H8N2O4S — CID 101372178
2-(2,3-dioxoaziridin-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 101372178) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-(2,3-dioxoaziridin-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-(2,3-dioxoaziridin-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 101372178 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-(2,3-dioxoaziridin-1-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(-n2c(=O)c2=O)sc2c1CCNC2 |
| InChI | InChI=1S/C10H8N2O4S/c13-7-8(14)12(7)9-6(10(15)16)4-1-2-11-3-5(4)17-9/h11H,1-3H2,(H,15,16) |
| InChIKey | KVXOLYPREAOTEI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|