C12H12Cl3N3 — CID 101372606
2-[2-[3-(trichloromethyl)phenyl]-1H-imidazol-5-yl]ethanamine (PubChem CID 101372606) has the molecular formula C12H12Cl3N3 and a molecular weight of 304.61 g/mol. Its IUPAC name is 2-[2-[3-(trichloromethyl)phenyl]-1H-imidazol-5-yl]ethanamine.
| Compound Name | 2-[2-[3-(trichloromethyl)phenyl]-1H-imidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 101372606 |
| Molecular Formula | C12H12Cl3N3 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-[2-[3-(trichloromethyl)phenyl]-1H-imidazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(-c2cccc(C(Cl)(Cl)Cl)c2)[nH]1 |
| InChI | InChI=1S/C12H12Cl3N3/c13-12(14,15)9-3-1-2-8(6-9)11-17-7-10(18-11)4-5-16/h1-3,6-7H,4-5,16H2,(H,17,18) |
| InChIKey | ZKFJLCMLLQZNOO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|