C26H24ClN3O4S — CID 101372708
2-chloro-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperazin-1-yl]naphthalene-1,4-dione (PubChem CID 101372708) has the molecular formula C26H24ClN3O4S and a molecular weight of 510.02 g/mol. Its IUPAC name is 2-chloro-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperazin-1-yl]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperazin-1-yl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 101372708 |
| Molecular Formula | C26H24ClN3O4S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-chloro-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperazin-1-yl]naphthalene-1,4-dione |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCN(C4=C(Cl)C(=O)c5ccccc5C4=O)CC3)cccc12 |
| InChI | InChI=1S/C26H24ClN3O4S/c1-28(2)21-11-5-10-18-17(21)9-6-12-22(18)35(33,34)30-15-13-29(14-16-30)24-23(27)25(31)19-7-3-4-8-20(19)26(24)32/h3-12H,13-16H2,1-2H3 |
| InChIKey | ZWABUFZUKAUXKD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|