C25H46O4Si — CID 101372772
(5S)-5-[(E,7R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-3,7-dimethyloct-2-enyl]-5-methylcyclopentene-1-carbaldehyde (PubChem CID 101372772) has the molecular formula C25H46O4Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (5S)-5-[(E,7R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-3,7-dimethyloct-2-enyl]-5-methylcyclopentene-1-carbaldehyde.
| Compound Name | (5S)-5-[(E,7R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-3,7-dimethyloct-2-enyl]-5-methylcyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 101372772 |
| Molecular Formula | C25H46O4Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (5S)-5-[(E,7R)-8-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-3,7-dimethyloct-2-enyl]-5-methylcyclopentene-1-carbaldehyde |
| SMILES | COCOC(C/C(C)=C/C[C@]1(C)CCC=C1C=O)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O4Si/c1-20(12-14-25(6)13-10-11-22(25)17-26)15-23(28-19-27-7)16-21(2)18-29-30(8,9)24(3,4)5/h11-12,17,21,23H,10,13-16,18-19H2,1-9H3/b20-12+/t21-,23?,25+/m1/s1 |
| InChIKey | SEVYDIBXTSTYIB-JYSATGJLSA-N |
| XLogP | 6.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|