C20H30O3 — CID 101372775
(1S,3R,7S,10R,17S)-3,7,10,14-tetramethyl-16-oxatricyclo[8.6.1.013,17]heptadec-13-ene-5,15-dione (PubChem CID 101372775) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,3R,7S,10R,17S)-3,7,10,14-tetramethyl-16-oxatricyclo[8.6.1.013,17]heptadec-13-ene-5,15-dione.
| Compound Name | (1S,3R,7S,10R,17S)-3,7,10,14-tetramethyl-16-oxatricyclo[8.6.1.013,17]heptadec-13-ene-5,15-dione |
|---|---|
| PubChem CID | 101372775 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,3R,7S,10R,17S)-3,7,10,14-tetramethyl-16-oxatricyclo[8.6.1.013,17]heptadec-13-ene-5,15-dione |
| SMILES | CC1=C2CC[C@@]3(C)CC[C@H](C)CC(=O)C[C@H](C)C[C@H](OC1=O)[C@H]23 |
| InChI | InChI=1S/C20H30O3/c1-12-5-7-20(4)8-6-16-14(3)19(22)23-17(18(16)20)11-13(2)10-15(21)9-12/h12-13,17-18H,5-11H2,1-4H3/t12-,13-,17-,18-,20+/m0/s1 |
| InChIKey | YPAYJFSZNKIHQZ-MRCBJOPHSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |