C14H12BrNO4 — CID 101372829
[4-(2,5-dioxopyrrol-1-yl)phenyl] 2-bromobutanoate (PubChem CID 101372829) has the molecular formula C14H12BrNO4 and a molecular weight of 338.16 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrol-1-yl)phenyl] 2-bromobutanoate.
| Compound Name | [4-(2,5-dioxopyrrol-1-yl)phenyl] 2-bromobutanoate |
|---|---|
| PubChem CID | 101372829 |
| Molecular Formula | C14H12BrNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | [4-(2,5-dioxopyrrol-1-yl)phenyl] 2-bromobutanoate |
| SMILES | CCC(Br)C(=O)Oc1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C14H12BrNO4/c1-2-11(15)14(19)20-10-5-3-9(4-6-10)16-12(17)7-8-13(16)18/h3-8,11H,2H2,1H3 |
| InChIKey | BZFNVQAQWBUWTF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|