C27H26N2O3 — CID 10137291
3-(3-Hydroxypropyl)-7-(1-methoxyethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),17,19,21-nonaen-14-one (PubChem CID 10137291) has the molecular formula C27H26N2O3 and a molecular weight of 426.50 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-7-(1-methoxyethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),17,19,21-nonaen-14-one.
| Compound Name | 3-(3-Hydroxypropyl)-7-(1-methoxyethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),17,19,21-nonaen-14-one |
|---|---|
| PubChem CID | 10137291 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-(3-hydroxypropyl)-7-(1-methoxyethyl)-3,13-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4(9),5,7,11(15),17,19,21-nonaen-14-one |
| SMILES | CC(C1=CC2=C(C=C1)N(C3=C2C4=C(C5=C3CC6=CC=CC=C65)C(=O)NC4)CCCO)OC |
| InChI | InChI=1S/C27H26N2O3/c1-15(32-2)16-8-9-22-19(12-16)24-21-14-28-27(31)25(21)23-18-7-4-3-6-17(18)13-20(23)26(24)29(22)10-5-11-30/h3-4,6-9,12,15,30H,5,10-11,13-14H2,1-2H3,(H,28,31) |
| InChIKey | AQMQNHMJAJDOKG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | 715 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |