About CID 101373160
CID 101373160 (PubChem CID 101373160) has the molecular formula C32H53O2
and a molecular weight of 469.77 g/mol.
Molecular Properties
| Compound Name | CID 101373160 |
| PubChem CID | 101373160 |
| Molecular Formula | C32H53O2 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.40 |
| IUPAC Name | — |
| SMILES | C/C(=C\CC1(C)CCc2c(cc(C)c([O])c2C)O1)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C32H53O2/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-17-26(5)18-20-32(8)21-19-29-28(7)31(33)27(6)22-30(29)34-32/h18,22-25H,9-17,19-21H2,1-8H3/b26-18+/t24-,25-,32?/m1/s1 |
| InChIKey | HTCUKZYUCXBNTH-RDHJHYBVSA-N |
| XLogP | 10.31 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 101373160 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101373160?
The IUPAC name of CID 101373160 (CID 101373160) is not available.
What is the SMILES notation for CID 101373160?
The canonical SMILES for CID 101373160 is C/C(=C\CC1(C)CCc2c(cc(C)c([O])c2C)O1)CCC[C@H](C)CCC[C@H](C)CCCC(C)C.
What is the InChIKey of CID 101373160?
The InChIKey is HTCUKZYUCXBNTH-RDHJHYBVSA-N. The full InChI is InChI=1S/C32H53O2/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-17-26(5)18-20-32(8)21-19-29-28(7)31(33)27(6)22-30(29)34-32/h18,22-25H,9-17,19-21H2,1-8H3/b26-18+/t24-,25-,32?/m1/s1.
What are the key properties of CID 101373160?
CID 101373160 has a molecular weight of 469.77 g/mol, XLogP of 10.31, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101373160 is sourced from PubChem (CID 101373160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).