C21H24F3NO5 — CID 10137337
2-methyl-5-[4-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 10137337) has the molecular formula C21H24F3NO5 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-methyl-5-[4-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10137337 |
| Molecular Formula | C21H24F3NO5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-methyl-5-[4-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]butyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | Cc1oc(-c2ccc(C(F)(F)F)cc2)nc1CCCCC1COC(C)(C(=O)O)OC1 |
| InChI | InChI=1S/C21H24F3NO5/c1-13-17(6-4-3-5-14-11-28-20(2,19(26)27)29-12-14)25-18(30-13)15-7-9-16(10-8-15)21(22,23)24/h7-10,14H,3-6,11-12H2,1-2H3,(H,26,27) |
| InChIKey | KAUNZIIPVKQMIZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|