About 1-phenyl-5H-triazolo[5,1-a]isoindole
1-phenyl-5H-triazolo[5,1-a]isoindole (PubChem CID 101373390) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-phenyl-5H-triazolo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 1-phenyl-5H-triazolo[5,1-a]isoindole |
| PubChem CID | 101373390 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-phenyl-5H-triazolo[5,1-a]isoindole |
| SMILES | c1ccc(-c2nnn3c2-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C15H11N3/c1-2-6-11(7-3-1)14-15-13-9-5-4-8-12(13)10-18(15)17-16-14/h1-9H,10H2 |
| InChIKey | RPHFMXCRKXTHCB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-5H-triazolo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5H-triazolo[5,1-a]isoindole?
The IUPAC name of 1-phenyl-5H-triazolo[5,1-a]isoindole (CID 101373390) is 1-phenyl-5H-triazolo[5,1-a]isoindole.
What is the SMILES notation for 1-phenyl-5H-triazolo[5,1-a]isoindole?
The canonical SMILES for 1-phenyl-5H-triazolo[5,1-a]isoindole is c1ccc(-c2nnn3c2-c2ccccc2C3)cc1.
What is the InChIKey of 1-phenyl-5H-triazolo[5,1-a]isoindole?
The InChIKey is RPHFMXCRKXTHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c1-2-6-11(7-3-1)14-15-13-9-5-4-8-12(13)10-18(15)17-16-14/h1-9H,10H2.
What are the key properties of 1-phenyl-5H-triazolo[5,1-a]isoindole?
1-phenyl-5H-triazolo[5,1-a]isoindole has a molecular weight of 233.27 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5H-triazolo[5,1-a]isoindole is sourced from PubChem (CID 101373390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).