About 5-fluoro-3,3-dimethyl-2-nonylpyrrole
5-fluoro-3,3-dimethyl-2-nonylpyrrole (PubChem CID 101373741) has the molecular formula C15H26FN
and a molecular weight of 239.38 g/mol. Its IUPAC name is 5-fluoro-3,3-dimethyl-2-nonylpyrrole.
Molecular Properties
| Compound Name | 5-fluoro-3,3-dimethyl-2-nonylpyrrole |
| PubChem CID | 101373741 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 5-fluoro-3,3-dimethyl-2-nonylpyrrole |
| SMILES | CCCCCCCCCC1=NC(F)=CC1(C)C |
| InChI | InChI=1S/C15H26FN/c1-4-5-6-7-8-9-10-11-13-15(2,3)12-14(16)17-13/h12H,4-11H2,1-3H3 |
| InChIKey | VYABTLCZDMZSGJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3,3-dimethyl-2-nonylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,3-dimethyl-2-nonylpyrrole?
The IUPAC name of 5-fluoro-3,3-dimethyl-2-nonylpyrrole (CID 101373741) is 5-fluoro-3,3-dimethyl-2-nonylpyrrole.
What is the SMILES notation for 5-fluoro-3,3-dimethyl-2-nonylpyrrole?
The canonical SMILES for 5-fluoro-3,3-dimethyl-2-nonylpyrrole is CCCCCCCCCC1=NC(F)=CC1(C)C.
What is the InChIKey of 5-fluoro-3,3-dimethyl-2-nonylpyrrole?
The InChIKey is VYABTLCZDMZSGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26FN/c1-4-5-6-7-8-9-10-11-13-15(2,3)12-14(16)17-13/h12H,4-11H2,1-3H3.
What are the key properties of 5-fluoro-3,3-dimethyl-2-nonylpyrrole?
5-fluoro-3,3-dimethyl-2-nonylpyrrole has a molecular weight of 239.38 g/mol, XLogP of 5.42, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,3-dimethyl-2-nonylpyrrole is sourced from PubChem (CID 101373741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).