About 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid
2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid (PubChem CID 101373745) has the molecular formula C15H22O6
and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid |
| PubChem CID | 101373745 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid |
| SMILES | COC(=O)C(CC[C@@H]1C=C[C@H](CC(=O)O)CC1)C(=O)OC |
| InChI | InChI=1S/C15H22O6/c1-20-14(18)12(15(19)21-2)8-7-10-3-5-11(6-4-10)9-13(16)17/h3,5,10-12H,4,6-9H2,1-2H3,(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | AZSUZWBSGSCAQF-MNOVXSKESA-N |
| XLogP | 1.79 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid?
The IUPAC name of 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid (CID 101373745) is 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid.
What is the SMILES notation for 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid?
The canonical SMILES for 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid is COC(=O)C(CC[C@@H]1C=C[C@H](CC(=O)O)CC1)C(=O)OC.
What is the InChIKey of 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid?
The InChIKey is AZSUZWBSGSCAQF-MNOVXSKESA-N. The full InChI is InChI=1S/C15H22O6/c1-20-14(18)12(15(19)21-2)8-7-10-3-5-11(6-4-10)9-13(16)17/h3,5,10-12H,4,6-9H2,1-2H3,(H,16,17)/t10-,11+/m1/s1.
What are the key properties of 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid?
2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid has a molecular weight of 298.34 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,4R)-4-(4-methoxy-3-methoxycarbonyl-4-oxobutyl)cyclohex-2-en-1-yl]acetic acid is sourced from PubChem (CID 101373745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).